C36H35BO2Si — CID 164756518
[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane (PubChem CID 164756518) has the molecular formula C36H35BO2Si and a molecular weight of 543.60 g/mol. Its IUPAC name is [3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane.
| Compound Name | [3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 164756518 |
| Molecular Formula | C36H35BO2Si |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H35BO2Si/c1-35(2)36(3,4)39-37(38-35)30-23-25-33(26-24-30)40(31-18-10-6-11-19-31,32-20-12-7-13-21-32)34-22-14-17-29(27-34)28-15-8-5-9-16-28/h5-27H,1-4H3/i5D,8D,9D,15D,16D |
| InChIKey | UTZSWIBGBFCKJT-FJCQIMOMSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|