C36H33BO3Si — CID 177089483
dibenzofuran-2-yl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane (PubChem CID 177089483) has the molecular formula C36H33BO3Si and a molecular weight of 552.56 g/mol. Its IUPAC name is dibenzofuran-2-yl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane.
| Compound Name | dibenzofuran-2-yl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 177089483 |
| Molecular Formula | C36H33BO3Si |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | dibenzofuran-2-yl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
| SMILES | CC1(C)OB(c2ccc([Si](c3ccccc3)(c3ccccc3)c3ccc4oc5ccccc5c4c3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H33BO3Si/c1-35(2)36(3,4)40-37(39-35)26-19-21-29(22-20-26)41(27-13-7-5-8-14-27,28-15-9-6-10-16-28)30-23-24-34-32(25-30)31-17-11-12-18-33(31)38-34/h5-25H,1-4H3 |
| InChIKey | BISZNKZSNZJRMW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|