C17H18BNO3 — CID 142598773
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-c]pyridine (PubChem CID 142598773) has the molecular formula C17H18BNO3 and a molecular weight of 295.15 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 142598773 |
| Molecular Formula | C17H18BNO3 |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[2,3-c]pyridine |
| SMILES | CC1(C)OB(c2cc3c(cn2)oc2ccccc23)OC1(C)C |
| InChI | InChI=1S/C17H18BNO3/c1-16(2)17(3,4)22-18(21-16)15-9-12-11-7-5-6-8-13(11)20-14(12)10-19-15/h5-10H,1-4H3 |
| InChIKey | OBNRZYARJKZATO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|