C33H28BN3O3 — CID 153289648
2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,3,5-triazine (PubChem CID 153289648) has the molecular formula C33H28BN3O3 and a molecular weight of 525.42 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 153289648 |
| Molecular Formula | C33H28BN3O3 |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 2,4-diphenyl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc3oc4ccccc4c3cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)OC1(C)C |
| InChI | InChI=1S/C33H28BN3O3/c1-32(2)33(3,4)40-34(39-32)26-20-28-24(23-17-11-12-18-27(23)38-28)19-25(26)31-36-29(21-13-7-5-8-14-21)35-30(37-31)22-15-9-6-10-16-22/h5-20H,1-4H3 |
| InChIKey | YQUSEJLKBYOZBT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|