C33H26BN3O4 — CID 176740304
2,4-di(dibenzofuran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine (PubChem CID 176740304) has the molecular formula C33H26BN3O4 and a molecular weight of 539.40 g/mol. Its IUPAC name is 2,4-di(dibenzofuran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine.
| Compound Name | 2,4-di(dibenzofuran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176740304 |
| Molecular Formula | C33H26BN3O4 |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 2,4-di(dibenzofuran-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine |
| SMILES | CC1(C)OB(c2nc(-c3ccc4oc5ccccc5c4c3)nc(-c3ccc4oc5ccccc5c4c3)n2)OC1(C)C |
| InChI | InChI=1S/C33H26BN3O4/c1-32(2)33(3,4)41-34(40-32)31-36-29(19-13-15-27-23(17-19)21-9-5-7-11-25(21)38-27)35-30(37-31)20-14-16-28-24(18-20)22-10-6-8-12-26(22)39-28/h5-18H,1-4H3 |
| InChIKey | DHEDYIRAKSXBQY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 83.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|