C23H22B55NO3 — CID 160608292
CID 160608292 (PubChem CID 160608292) has the molecular formula C23H22B55NO3 and a molecular weight of 955.09 g/mol.
| Compound Name | CID 160608292 |
|---|---|
| PubChem CID | 160608292 |
| Molecular Formula | C23H22B55NO3 |
| Molecular Weight | 955.09 g/mol |
| Exact Mass | 965.67 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4oc5ccccc5c4c3)nc2)OC1(C)C.[B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C23H22BNO3.B54/c1-22(2)23(3,4)28-24(27-22)16-10-11-19(25-14-16)15-9-12-21-18(13-15)17-7-5-6-8-20(17)26-21;1-29(2)43(30(3)4)50(44(31(5)6)32(7)8)53(49(41(25)26)42(27)28)54(51(45(33(9)10)34(11)12)46(35(13)14)36(15)16)52(47(37(17)18)38(19)20)48(39(21)22)40(23)24/h5-14H,1-4H3; |
| InChIKey | PAVHTWZCEOQIBN-UHFFFAOYSA-N |
| XLogP | -15.62 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 82 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.09 |
| LogP ≤ 5 | -15.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|