C25H29BO2Si — CID 171832535
methyl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane (PubChem CID 171832535) has the molecular formula C25H29BO2Si and a molecular weight of 400.40 g/mol. Its IUPAC name is methyl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane.
| Compound Name | methyl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 171832535 |
| Molecular Formula | C25H29BO2Si |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl-diphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]silane |
| SMILES | CC1(C)OB(c2ccc([Si](C)(c3ccccc3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C25H29BO2Si/c1-24(2)25(3,4)28-26(27-24)20-16-18-23(19-17-20)29(5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-19H,1-5H3 |
| InChIKey | QEUYUSCWQZOHEC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|