C42H50B2O4 — CID 89459060
2-[4-[4,4-diphenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 89459060) has the molecular formula C42H50B2O4 and a molecular weight of 640.48 g/mol. Its IUPAC name is 2-[4-[4,4-diphenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[4,4-diphenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89459060 |
| Molecular Formula | C42H50B2O4 |
| Molecular Weight | 640.48 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | 2-[4-[4,4-diphenyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C3(c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)CCC(c4ccccc4)(c4ccccc4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C42H50B2O4/c1-37(2)38(3,4)46-43(45-37)35-23-19-33(20-24-35)42(34-21-25-36(26-22-34)44-47-39(5,6)40(7,8)48-44)29-27-41(28-30-42,31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-26H,27-30H2,1-8H3 |
| InChIKey | KIMNFXPKYZUGAO-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.48 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|