C16H23BO4S — CID 90042187
3-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thietane 1,1-dioxide (PubChem CID 90042187) has the molecular formula C16H23BO4S and a molecular weight of 322.24 g/mol. Its IUPAC name is 3-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thietane 1,1-dioxide.
| Compound Name | 3-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thietane 1,1-dioxide |
|---|---|
| PubChem CID | 90042187 |
| Molecular Formula | C16H23BO4S |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thietane 1,1-dioxide |
| SMILES | CC1(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23BO4S/c1-14(2)15(3,4)21-17(20-14)13-8-6-12(7-9-13)16(5)10-22(18,19)11-16/h6-9H,10-11H2,1-5H3 |
| InChIKey | JWLCLTYDJMBKND-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|