C13H21BO4 — CID 158702164
methanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (PubChem CID 158702164) has the molecular formula C13H21BO4 and a molecular weight of 252.12 g/mol. Its IUPAC name is methanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol.
| Compound Name | methanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| PubChem CID | 158702164 |
| Molecular Formula | C13H21BO4 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | methanol;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| SMILES | CC1(C)OB(c2ccc(O)cc2)OC1(C)C.CO |
| InChI | InChI=1S/C12H17BO3.CH4O/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9;1-2/h5-8,14H,1-4H3;2H,1H3 |
| InChIKey | IHRFQKXLWDBLHF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|