C19H21BO4 — CID 162386659
(4-hydroxyphenyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 162386659) has the molecular formula C19H21BO4 and a molecular weight of 324.19 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (4-hydroxyphenyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 162386659 |
| Molecular Formula | C19H21BO4 |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (4-hydroxyphenyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)c3ccc(O)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H21BO4/c1-18(2)19(3,4)24-20(23-18)15-9-5-13(6-10-15)17(22)14-7-11-16(21)12-8-14/h5-12,21H,1-4H3 |
| InChIKey | SVOLQZNWBRUPEF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|