C19H19BF3NO3 — CID 90399283
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[5-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 90399283) has the molecular formula C19H19BF3NO3 and a molecular weight of 377.17 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[5-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 90399283 |
| Molecular Formula | C19H19BF3NO3 |
| Molecular Weight | 377.17 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)c3ccc(C(F)(F)F)cn3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H19BF3NO3/c1-17(2)18(3,4)27-20(26-17)14-8-5-12(6-9-14)16(25)15-10-7-13(11-24-15)19(21,22)23/h5-11H,1-4H3 |
| InChIKey | UZURRQTUJFKAPY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|