C25H32BNO3 — CID 143414289
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-(3,5,8-trimethyl-5,6,7,8-tetrahydronaphthalen-2-yl)methanone (PubChem CID 143414289) has the molecular formula C25H32BNO3 and a molecular weight of 405.35 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-(3,5,8-trimethyl-5,6,7,8-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-(3,5,8-trimethyl-5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 143414289 |
| Molecular Formula | C25H32BNO3 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-(3,5,8-trimethyl-5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(B3OC(C)(C)C(C)(C)O3)cn1)C(C)CCC2C |
| InChI | InChI=1S/C25H32BNO3/c1-15-8-9-16(2)20-13-21(17(3)12-19(15)20)23(28)22-11-10-18(14-27-22)26-29-24(4,5)25(6,7)30-26/h10-16H,8-9H2,1-7H3 |
| InChIKey | HHVNZIUFTTZFDW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|