C27H38BN3O2 — CID 59807011
(Z)-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylidene]hydrazine (PubChem CID 59807011) has the molecular formula C27H38BN3O2 and a molecular weight of 447.43 g/mol. Its IUPAC name is (Z)-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylidene]hydrazine.
| Compound Name | (Z)-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylidene]hydrazine |
|---|---|
| PubChem CID | 59807011 |
| Molecular Formula | C27H38BN3O2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | (Z)-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methylidene]hydrazine |
| SMILES | Cc1cc2c(cc1/C(=N/N)c1ccc(B3OC(C)(C)C(C)(C)O3)cn1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H38BN3O2/c1-17-14-20-21(25(4,5)13-12-24(20,2)3)15-19(17)23(31-29)22-11-10-18(16-30-22)28-32-26(6,7)27(8,9)33-28/h10-11,14-16H,12-13,29H2,1-9H3/b31-23- |
| InChIKey | DSVZTPYRFJIAKD-SXBRIOAWSA-N |
| XLogP | 4.75 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|