C28H39BN2O2 — CID 173499164
[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazine (PubChem CID 173499164) has the molecular formula C28H39BN2O2 and a molecular weight of 446.44 g/mol. Its IUPAC name is [(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazine.
| Compound Name | [(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazine |
|---|---|
| PubChem CID | 173499164 |
| Molecular Formula | C28H39BN2O2 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | [(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazine |
| SMILES | Cc1cc2c(cc1C(=NN)c1ccc(B3OC(C)(C)C(C)(C)O3)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H39BN2O2/c1-18-16-22-23(26(4,5)15-14-25(22,2)3)17-21(18)24(31-30)19-10-12-20(13-11-19)29-32-27(6,7)28(8,9)33-29/h10-13,16-17H,14-15,30H2,1-9H3 |
| InChIKey | SIUCYZUVWQADOW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|