C23H29BrN2 — CID 142982133
(Z)-[(4-bromophenyl)-(5-ethyl-3,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]hydrazine (PubChem CID 142982133) has the molecular formula C23H29BrN2 and a molecular weight of 413.40 g/mol. Its IUPAC name is (Z)-[(4-bromophenyl)-(5-ethyl-3,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]hydrazine.
| Compound Name | (Z)-[(4-bromophenyl)-(5-ethyl-3,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]hydrazine |
|---|---|
| PubChem CID | 142982133 |
| Molecular Formula | C23H29BrN2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (Z)-[(4-bromophenyl)-(5-ethyl-3,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]hydrazine |
| SMILES | CCC1(C)CCC(C)(C)c2cc(/C(=N\N)c3ccc(Br)cc3)c(C)cc21 |
| InChI | InChI=1S/C23H29BrN2/c1-6-23(5)12-11-22(3,4)19-14-18(15(2)13-20(19)23)21(26-25)16-7-9-17(24)10-8-16/h7-10,13-14H,6,11-12,25H2,1-5H3/b26-21- |
| InChIKey | UUFNKOAYFLMBFW-QLYXXIJNSA-N |
| XLogP | 6.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|