C27H37NO — CID 87851801
(E)-N-butoxy-1-(4-methylphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methanimine (PubChem CID 87851801) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is (E)-N-butoxy-1-(4-methylphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methanimine.
| Compound Name | (E)-N-butoxy-1-(4-methylphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methanimine |
|---|---|
| PubChem CID | 87851801 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | (E)-N-butoxy-1-(4-methylphenyl)-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methanimine |
| SMILES | CCCCO/N=C(\c1ccc(C)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H37NO/c1-8-9-16-29-28-25(21-12-10-19(2)11-13-21)22-18-24-23(17-20(22)3)26(4,5)14-15-27(24,6)7/h10-13,17-18H,8-9,14-16H2,1-7H3/b28-25+ |
| InChIKey | QKUADRABDIHHLM-AZPGRJICSA-N |
| XLogP | 7.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|