C36H45NO8S — CID 101401455
4-[(Z)-N-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid (PubChem CID 101401455) has the molecular formula C36H45NO8S and a molecular weight of 651.82 g/mol. Its IUPAC name is 4-[(Z)-N-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid.
| Compound Name | 4-[(Z)-N-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 101401455 |
| Molecular Formula | C36H45NO8S |
| Molecular Weight | 651.82 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | 4-[(Z)-N-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-C-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCO/N=C(/c2ccc(C(=O)O)cc2)c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C36H45NO8S/c1-25-7-13-29(14-8-25)46(40,41)45-22-20-43-18-17-42-19-21-44-37-33(27-9-11-28(12-10-27)34(38)39)30-24-32-31(23-26(30)2)35(3,4)15-16-36(32,5)6/h7-14,23-24H,15-22H2,1-6H3,(H,38,39)/b37-33- |
| InChIKey | HJCGAOIHYMPWPV-FJSCPDHXSA-N |
| XLogP | 6.56 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|