C24H28O2 — CID 170653108
4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl](11C)benzoic acid (PubChem CID 170653108) has the molecular formula C24H28O2 and a molecular weight of 347.49 g/mol. Its IUPAC name is 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl](11C)benzoic acid.
| Compound Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl](11C)benzoic acid |
|---|---|
| PubChem CID | 170653108 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl](11C)benzoic acid |
| SMILES | C=C(c1ccc([11C](=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28O2/c1-15-13-20-21(24(5,6)12-11-23(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)22(25)26/h7-10,13-14H,2,11-12H2,1,3-6H3,(H,25,26)/i22-1 |
| InChIKey | NAVMQTYZDKMPEU-KVTPGWOSSA-N |
| XLogP | 6.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |