C30H43NO2 — CID 175159215
N-ethylethanamine;2-ethyl-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 175159215) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is N-ethylethanamine;2-ethyl-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | N-ethylethanamine;2-ethyl-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 175159215 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | N-ethylethanamine;2-ethyl-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)c(CC)c1)c1cc2c(cc1C)C(C)(C)CCC2(C)C.CCNCC |
| InChI | InChI=1S/C26H32O2.C4H11N/c1-8-18-14-19(9-10-20(18)24(27)28)17(3)21-15-23-22(13-16(21)2)25(4,5)11-12-26(23,6)7;1-3-5-4-2/h9-10,13-15H,3,8,11-12H2,1-2,4-7H3,(H,27,28);5H,3-4H2,1-2H3 |
| InChIKey | RFWPGOKKIGNKLF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |