C30H33NO2 — CID 20707155
(4-aminophenyl) 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate (PubChem CID 20707155) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is (4-aminophenyl) 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate.
| Compound Name | (4-aminophenyl) 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 20707155 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (4-aminophenyl) 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
| SMILES | C=C(c1ccc(C(=O)Oc2ccc(N)cc2)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H33NO2/c1-19-17-26-27(30(5,6)16-15-29(26,3)4)18-25(19)20(2)21-7-9-22(10-8-21)28(32)33-24-13-11-23(31)12-14-24/h7-14,17-18H,2,15-16,31H2,1,3-6H3 |
| InChIKey | JZGHZYPZXZISPN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|