C25H31NO2S — CID 10409258
O-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 10409258) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is O-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 10409258 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | O-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(OC(=S)N(C)C)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H31NO2S/c1-16-14-20-21(25(4,5)13-12-24(20,2)3)15-19(16)22(27)17-8-10-18(11-9-17)28-23(29)26(6)7/h8-11,14-15H,12-13H2,1-7H3 |
| InChIKey | UWGNZOCMOCFNJA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|