C32H37NO2 — CID 70455135
(4-aminophenyl) 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)but-1-enyl]benzoate (PubChem CID 70455135) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is (4-aminophenyl) 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)but-1-enyl]benzoate.
| Compound Name | (4-aminophenyl) 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 70455135 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (4-aminophenyl) 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)but-1-enyl]benzoate |
| SMILES | CCC(=Cc1ccc(C(=O)Oc2ccc(N)cc2)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H37NO2/c1-7-23(27-20-29-28(18-21(27)2)31(3,4)16-17-32(29,5)6)19-22-8-10-24(11-9-22)30(34)35-26-14-12-25(33)13-15-26/h8-15,18-20H,7,16-17,33H2,1-6H3 |
| InChIKey | HIDJIFLKQWHKSY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|