C27H34O2 — CID 54570625
ethyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate (PubChem CID 54570625) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is ethyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54570625 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | ethyl 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(C)c2cc3c(cc2CC)C(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C27H34O2/c1-8-20-15-23-24(27(6,7)17-26(23,4)5)16-22(20)18(3)14-19-10-12-21(13-11-19)25(28)29-9-2/h10-16H,8-9,17H2,1-7H3 |
| InChIKey | ZWZODCUWTHXHOU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|