C30H40O2 — CID 54079197
ethyl 4-[2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoate (PubChem CID 54079197) has the molecular formula C30H40O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is ethyl 4-[2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54079197 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | ethyl 4-[2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
| SMILES | CCCCc1cc2c(cc1C(C)=Cc1ccc(C(=O)OCC)cc1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C30H40O2/c1-9-11-12-24-18-26-27(30(7,8)21(4)29(26,5)6)19-25(24)20(3)17-22-13-15-23(16-14-22)28(31)32-10-2/h13-19,21H,9-12H2,1-8H3 |
| InChIKey | MLWJGIROEGBPSQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|