C25H30O3 — CID 54137669
ethyl 4-[2-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]prop-1-enyl]benzoate (PubChem CID 54137669) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is ethyl 4-[2-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[2-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54137669 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | ethyl 4-[2-[4-hydroxy-3-(1-methylcyclohexyl)phenyl]prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(C)c2ccc(O)c(C3(C)CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H30O3/c1-4-28-24(27)20-10-8-19(9-11-20)16-18(2)21-12-13-23(26)22(17-21)25(3)14-6-5-7-15-25/h8-13,16-17,26H,4-7,14-15H2,1-3H3 |
| InChIKey | NYVWTGWRCNMQGC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|