C29H34O3 — CID 10741296
ethyl 4-[(E)-2-[3-(1-adamantyl)-4-methoxyphenyl]prop-1-enyl]benzoate (PubChem CID 10741296) has the molecular formula C29H34O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is ethyl 4-[(E)-2-[3-(1-adamantyl)-4-methoxyphenyl]prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-[3-(1-adamantyl)-4-methoxyphenyl]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 10741296 |
| Molecular Formula | C29H34O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethyl 4-[(E)-2-[3-(1-adamantyl)-4-methoxyphenyl]prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C(\C)c2ccc(OC)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C29H34O3/c1-4-32-28(30)24-7-5-20(6-8-24)11-19(2)25-9-10-27(31-3)26(15-25)29-16-21-12-22(17-29)14-23(13-21)18-29/h5-11,15,21-23H,4,12-14,16-18H2,1-3H3/b19-11+ |
| InChIKey | SCJLQDMUKJUBOM-YBFXNURJSA-N |
| XLogP | 6.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|