C22H24O2S2 — CID 19935455
ethyl 4-[(E)-2-(3-methyl-3,4-dihydro-2H-1,5-benzodithiepin-7-yl)prop-1-enyl]benzoate (PubChem CID 19935455) has the molecular formula C22H24O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is ethyl 4-[(E)-2-(3-methyl-3,4-dihydro-2H-1,5-benzodithiepin-7-yl)prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-(3-methyl-3,4-dihydro-2H-1,5-benzodithiepin-7-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 19935455 |
| Molecular Formula | C22H24O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 4-[(E)-2-(3-methyl-3,4-dihydro-2H-1,5-benzodithiepin-7-yl)prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C(\C)c2ccc3c(c2)SCC(C)CS3)cc1 |
| InChI | InChI=1S/C22H24O2S2/c1-4-24-22(23)18-7-5-17(6-8-18)11-16(3)19-9-10-20-21(12-19)26-14-15(2)13-25-20/h5-12,15H,4,13-14H2,1-3H3/b16-11+ |
| InChIKey | QWJNWMSPCGLJHW-LFIBNONCSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|