C29H38O2 — CID 54257451
ethyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate (PubChem CID 54257451) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is ethyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54257451 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | ethyl 4-[2-[1,1,3,3-tetramethyl-6-(2-methylpropyl)-2H-inden-5-yl]prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(C)c2cc3c(cc2CC(C)C)C(C)(C)CC3(C)C)cc1 |
| InChI | InChI=1S/C29H38O2/c1-9-31-27(30)22-12-10-21(11-13-22)15-20(4)24-17-26-25(16-23(24)14-19(2)3)28(5,6)18-29(26,7)8/h10-13,15-17,19H,9,14,18H2,1-8H3 |
| InChIKey | RBBYVZDXVCZTSS-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|