C31H35NO2 — CID 70456249
(4-aminophenyl) 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate (PubChem CID 70456249) has the molecular formula C31H35NO2 and a molecular weight of 453.63 g/mol. Its IUPAC name is (4-aminophenyl) 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate.
| Compound Name | (4-aminophenyl) 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 70456249 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (4-aminophenyl) 4-[2-(6-ethyl-1,1,3,3-tetramethyl-2H-inden-5-yl)prop-1-enyl]benzoate |
| SMILES | CCc1cc2c(cc1C(C)=Cc1ccc(C(=O)Oc3ccc(N)cc3)cc1)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C31H35NO2/c1-7-22-17-27-28(31(5,6)19-30(27,3)4)18-26(22)20(2)16-21-8-10-23(11-9-21)29(33)34-25-14-12-24(32)13-15-25/h8-18H,7,19,32H2,1-6H3 |
| InChIKey | XMXKNMLGHSFKMD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|