C32H39NO3 — CID 70455411
4-aminophenol;4-[2-(6-ethyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid (PubChem CID 70455411) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is 4-aminophenol;4-[2-(6-ethyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-aminophenol;4-[2-(6-ethyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70455411 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 4-aminophenol;4-[2-(6-ethyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
| SMILES | CCc1cc2c(cc1C(C)=Cc1ccc(C(=O)O)cc1)C(C)(C)C(C)C2(C)C.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C26H32O2.C6H7NO/c1-8-19-14-22-23(26(6,7)17(3)25(22,4)5)15-21(19)16(2)13-18-9-11-20(12-10-18)24(27)28;7-5-1-3-6(8)4-2-5/h9-15,17H,8H2,1-7H3,(H,27,28);1-4,8H,7H2 |
| InChIKey | PQICACLKJMDMDA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|