C31H42O2 — CID 54139601
4-[2-[6-(3-ethylpentyl)-1,1,2,3,3-pentamethyl-2H-inden-5-yl]prop-1-enyl]benzoic acid (PubChem CID 54139601) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is 4-[2-[6-(3-ethylpentyl)-1,1,2,3,3-pentamethyl-2H-inden-5-yl]prop-1-enyl]benzoic acid.
| Compound Name | 4-[2-[6-(3-ethylpentyl)-1,1,2,3,3-pentamethyl-2H-inden-5-yl]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 54139601 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 4-[2-[6-(3-ethylpentyl)-1,1,2,3,3-pentamethyl-2H-inden-5-yl]prop-1-enyl]benzoic acid |
| SMILES | CCC(CC)CCc1cc2c(cc1C(C)=Cc1ccc(C(=O)O)cc1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C31H42O2/c1-9-22(10-2)11-16-25-18-27-28(31(7,8)21(4)30(27,5)6)19-26(25)20(3)17-23-12-14-24(15-13-23)29(32)33/h12-15,17-19,21-22H,9-11,16H2,1-8H3,(H,32,33) |
| InChIKey | OADUWFGOMVCCCY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|