C34H43NO3 — CID 70455150
4-aminophenol;4-[(E)-2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid (PubChem CID 70455150) has the molecular formula C34H43NO3 and a molecular weight of 513.72 g/mol. Its IUPAC name is 4-aminophenol;4-[(E)-2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-aminophenol;4-[(E)-2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70455150 |
| Molecular Formula | C34H43NO3 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | 4-aminophenol;4-[(E)-2-(6-butyl-1,1,2,3,3-pentamethyl-2H-inden-5-yl)prop-1-enyl]benzoic acid |
| SMILES | CCCCc1cc2c(cc1/C(C)=C/c1ccc(C(=O)O)cc1)C(C)(C)C(C)C2(C)C.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C28H36O2.C6H7NO/c1-8-9-10-22-16-24-25(28(6,7)19(3)27(24,4)5)17-23(22)18(2)15-20-11-13-21(14-12-20)26(29)30;7-5-1-3-6(8)4-2-5/h11-17,19H,8-10H2,1-7H3,(H,29,30);1-4,8H,7H2/b18-15+; |
| InChIKey | PWQSQPJZLOHODZ-FLNCGGNMSA-N |
| XLogP | 8.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|