C38H49NO2 — CID 152614631
N-(4-hydroxyphenyl)-4-[2-(1,1,2,3,3-pentamethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzamide (PubChem CID 152614631) has the molecular formula C38H49NO2 and a molecular weight of 551.82 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-4-[2-(1,1,2,3,3-pentamethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzamide.
| Compound Name | N-(4-hydroxyphenyl)-4-[2-(1,1,2,3,3-pentamethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 152614631 |
| Molecular Formula | C38H49NO2 |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | N-(4-hydroxyphenyl)-4-[2-(1,1,2,3,3-pentamethyl-6-octyl-2H-inden-5-yl)prop-1-enyl]benzamide |
| SMILES | CCCCCCCCc1cc2c(cc1C(C)=Cc1ccc(C(=O)Nc3ccc(O)cc3)cc1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C38H49NO2/c1-8-9-10-11-12-13-14-30-24-34-35(38(6,7)27(3)37(34,4)5)25-33(30)26(2)23-28-15-17-29(18-16-28)36(41)39-31-19-21-32(40)22-20-31/h15-25,27,40H,8-14H2,1-7H3,(H,39,41) |
| InChIKey | ZAGBBAFIRZNONR-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|