C29H31NO2 — CID 18989925
N-(4-hydroxyphenyl)-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide (PubChem CID 18989925) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide.
| Compound Name | N-(4-hydroxyphenyl)-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide |
|---|---|
| PubChem CID | 18989925 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-(4-hydroxyphenyl)-4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C=C/c3ccc(C(=O)Nc4ccc(O)cc4)cc3)ccc21 |
| InChI | InChI=1S/C29H31NO2/c1-28(2)17-18-29(3,4)26-19-21(9-16-25(26)28)6-5-20-7-10-22(11-8-20)27(32)30-23-12-14-24(31)15-13-23/h5-16,19,31H,17-18H2,1-4H3,(H,30,32)/b6-5+ |
| InChIKey | XCNKZNGYXKNHAI-AATRIKPKSA-N |
| XLogP | 7.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|