C22H27O3P — CID 70356504
[4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]phosphonic acid (PubChem CID 70356504) has the molecular formula C22H27O3P and a molecular weight of 370.43 g/mol. Its IUPAC name is [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]phosphonic acid.
| Compound Name | [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 70356504 |
| Molecular Formula | C22H27O3P |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [4-[(E)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]phosphonic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C=C/c3ccc(P(=O)(O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H27O3P/c1-21(2)13-14-22(3,4)20-15-17(9-12-19(20)21)6-5-16-7-10-18(11-8-16)26(23,24)25/h5-12,15H,13-14H2,1-4H3,(H2,23,24,25)/b6-5+ |
| InChIKey | AKUJMYGFRAJGHK-AATRIKPKSA-N |
| XLogP | 5.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|