C26H22N2O6P2 — CID 58250279
[4-[(E)-2-[2-[4-[(E)-2-(4-phosphonophenyl)ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]phenyl]phosphonic acid (PubChem CID 58250279) has the molecular formula C26H22N2O6P2 and a molecular weight of 520.42 g/mol. Its IUPAC name is [4-[(E)-2-[2-[4-[(E)-2-(4-phosphonophenyl)ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]phenyl]phosphonic acid.
| Compound Name | [4-[(E)-2-[2-[4-[(E)-2-(4-phosphonophenyl)ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 58250279 |
| Molecular Formula | C26H22N2O6P2 |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | [4-[(E)-2-[2-[4-[(E)-2-(4-phosphonophenyl)ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(/C=C/c2ccnc(-c3cc(/C=C/c4ccc(P(=O)(O)O)cc4)ccn3)c2)cc1 |
| InChI | InChI=1S/C26H22N2O6P2/c29-35(30,31)23-9-5-19(6-10-23)1-3-21-13-15-27-25(17-21)26-18-22(14-16-28-26)4-2-20-7-11-24(12-8-20)36(32,33)34/h1-18H,(H2,29,30,31)(H2,32,33,34)/b3-1+,4-2+ |
| InChIKey | UQGDJUZLURZPEG-ZPUQHVIOSA-N |
| XLogP | 4.09 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|