C23H27NO3 — CID 19760315
[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl] acetate (PubChem CID 19760315) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 19760315 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-15(25)27-18-9-6-16(7-10-18)21(26)24-17-8-11-19-20(14-17)23(4,5)13-12-22(19,2)3/h6-11,14H,12-13H2,1-5H3,(H,24,26) |
| InChIKey | YJCDSRGMVYWJHE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|