C24H27NO4 — CID 24946634
3-oxo-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl]propanoic acid (PubChem CID 24946634) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 3-oxo-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl]propanoic acid.
| Compound Name | 3-oxo-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24946634 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-oxo-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]phenyl]propanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(NC(=O)c3ccc(C(=O)CC(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C24H27NO4/c1-23(2)11-12-24(3,4)19-13-17(9-10-18(19)23)25-22(29)16-7-5-15(6-8-16)20(26)14-21(27)28/h5-10,13H,11-12,14H2,1-4H3,(H,25,29)(H,27,28) |
| InChIKey | FHBPKTQVJYPNSH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|