C22H24FNO2S — CID 15463181
2-fluoro-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamothioyl]benzoic acid (PubChem CID 15463181) has the molecular formula C22H24FNO2S and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-fluoro-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamothioyl]benzoic acid.
| Compound Name | 2-fluoro-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamothioyl]benzoic acid |
|---|---|
| PubChem CID | 15463181 |
| Molecular Formula | C22H24FNO2S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-fluoro-4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamothioyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(NC(=S)c3ccc(C(=O)O)c(F)c3)ccc21 |
| InChI | InChI=1S/C22H24FNO2S/c1-21(2)9-10-22(3,4)17-12-14(6-8-16(17)21)24-19(27)13-5-7-15(20(25)26)18(23)11-13/h5-8,11-12H,9-10H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | YFWXHSFUROOTGH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|