C22H23N2O6P — CID 88523039
CID 88523039 (PubChem CID 88523039) has the molecular formula C22H23N2O6P and a molecular weight of 442.41 g/mol.
| Compound Name | CID 88523039 |
|---|---|
| PubChem CID | 88523039 |
| Molecular Formula | C22H23N2O6P |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc3c(c2)N(C(C)(C)P(=O)=O)C(=O)C3(C)C)cc1 |
| InChI | InChI=1S/C22H23N2O6P/c1-13(25)30-16-9-6-14(7-10-16)19(26)23-15-8-11-17-18(12-15)24(20(27)21(17,2)3)22(4,5)31(28)29/h6-12H,1-5H3,(H,23,26) |
| InChIKey | ZJJWAIIQBQSDOC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|