C16H11ClF3NO3 — CID 1254888
[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate (PubChem CID 1254888) has the molecular formula C16H11ClF3NO3 and a molecular weight of 357.72 g/mol. Its IUPAC name is [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 1254888 |
| Molecular Formula | C16H11ClF3NO3 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H11ClF3NO3/c1-9(22)24-12-5-2-10(3-6-12)15(23)21-11-4-7-14(17)13(8-11)16(18,19)20/h2-8H,1H3,(H,21,23) |
| InChIKey | JSQAXQCYQKOYLH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|