C29H21ClF3N5O6 — CID 86566578
[4-[[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carbonyl]amino]carbamoyl]phenyl] acetate (PubChem CID 86566578) has the molecular formula C29H21ClF3N5O6 and a molecular weight of 627.96 g/mol. Its IUPAC name is [4-[[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carbonyl]amino]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carbonyl]amino]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 86566578 |
| Molecular Formula | C29H21ClF3N5O6 |
| Molecular Weight | 627.96 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | [4-[[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carbonyl]amino]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)ccn2)cc1 |
| InChI | InChI=1S/C29H21ClF3N5O6/c1-16(39)43-20-7-2-17(3-8-20)26(40)37-38-27(41)25-15-22(12-13-34-25)44-21-9-4-18(5-10-21)35-28(42)36-19-6-11-24(30)23(14-19)29(31,32)33/h2-15H,1H3,(H,37,40)(H,38,41)(H2,35,36,42) |
| InChIKey | HDHDHQCZEZZSQM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|