C26H17ClF4N6O4 — CID 86566491
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[(5-fluoropyridine-3-carbonyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea (PubChem CID 86566491) has the molecular formula C26H17ClF4N6O4 and a molecular weight of 588.91 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[(5-fluoropyridine-3-carbonyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[(5-fluoropyridine-3-carbonyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 86566491 |
| Molecular Formula | C26H17ClF4N6O4 |
| Molecular Weight | 588.91 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[(5-fluoropyridine-3-carbonyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc(C(=O)NNC(=O)c3cncc(F)c3)c2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17ClF4N6O4/c27-21-6-3-17(10-20(21)26(29,30)31)35-25(40)34-16-1-4-18(5-2-16)41-19-7-8-33-22(11-19)24(39)37-36-23(38)14-9-15(28)13-32-12-14/h1-13H,(H,36,38)(H,37,39)(H2,34,35,40) |
| InChIKey | HIKRZDLMSGOGGL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|