C29H21ClF3N5O5 — CID 87057099
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea (PubChem CID 87057099) has the molecular formula C29H21ClF3N5O5 and a molecular weight of 611.96 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 87057099 |
| Molecular Formula | C29H21ClF3N5O5 |
| Molecular Weight | 611.96 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[[2-[[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]carbamoyl]-4-pyridinyl]oxy]phenyl]urea |
| SMILES | O=C(/C=C/c1ccc(O)cc1)NNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C29H21ClF3N5O5/c30-24-11-6-19(15-23(24)29(31,32)33)36-28(42)35-18-4-9-21(10-5-18)43-22-13-14-34-25(16-22)27(41)38-37-26(40)12-3-17-1-7-20(39)8-2-17/h1-16,39H,(H,37,40)(H,38,41)(H2,35,36,42)/b12-3+ |
| InChIKey | OCNJDYNNLYEUDA-KGVSQERTSA-N |
| XLogP | 6.37 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|