C27H18Cl2F3N5O4 — CID 86566353
1-[4-[[2-[[(4-chlorobenzoyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 86566353) has the molecular formula C27H18Cl2F3N5O4 and a molecular weight of 604.37 g/mol. Its IUPAC name is 1-[4-[[2-[[(4-chlorobenzoyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[[2-[[(4-chlorobenzoyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 86566353 |
| Molecular Formula | C27H18Cl2F3N5O4 |
| Molecular Weight | 604.37 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | 1-[4-[[2-[[(4-chlorobenzoyl)amino]carbamoyl]-4-pyridinyl]oxy]phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc(C(=O)NNC(=O)c3ccc(Cl)cc3)c2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H18Cl2F3N5O4/c28-16-3-1-15(2-4-16)24(38)36-37-25(39)23-14-20(11-12-33-23)41-19-8-5-17(6-9-19)34-26(40)35-18-7-10-22(29)21(13-18)27(30,31)32/h1-14H,(H,36,38)(H,37,39)(H2,34,35,40) |
| InChIKey | ORWOLFNSPFTFMS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.37 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|