C22H17ClF3N5O5 — CID 145477748
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[2-(hydroxyamino)-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 145477748) has the molecular formula C22H17ClF3N5O5 and a molecular weight of 523.86 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[2-(hydroxyamino)-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[2-(hydroxyamino)-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 145477748 |
| Molecular Formula | C22H17ClF3N5O5 |
| Molecular Weight | 523.86 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[2-(hydroxyamino)-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1)NO |
| InChI | InChI=1S/C22H17ClF3N5O5/c23-17-6-3-13(9-16(17)22(24,25)26)30-21(34)29-12-1-4-14(5-2-12)36-15-7-8-27-18(10-15)20(33)28-11-19(32)31-35/h1-10,35H,11H2,(H,28,33)(H,31,32)(H2,29,30,34) |
| InChIKey | KHWBVMMPYDWZTG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|