C26H24ClF3N4O4 — CID 146580274
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-(5-oxohexyl)pyridine-2-carboxamide (PubChem CID 146580274) has the molecular formula C26H24ClF3N4O4 and a molecular weight of 548.95 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-(5-oxohexyl)pyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-(5-oxohexyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146580274 |
| Molecular Formula | C26H24ClF3N4O4 |
| Molecular Weight | 548.95 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-(5-oxohexyl)pyridine-2-carboxamide |
| SMILES | CC(=O)CCCCNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C26H24ClF3N4O4/c1-16(35)4-2-3-12-32-24(36)23-15-20(11-13-31-23)38-19-8-5-17(6-9-19)33-25(37)34-18-7-10-22(27)21(14-18)26(28,29)30/h5-11,13-15H,2-4,12H2,1H3,(H,32,36)(H2,33,34,37) |
| InChIKey | IUSMBMPQCVDALG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|