C34H32ClF3N6O4 — CID 175374182
N-[9-(6-amino-3-pyridinyl)-7-oxonon-8-enyl]-4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide (PubChem CID 175374182) has the molecular formula C34H32ClF3N6O4 and a molecular weight of 681.12 g/mol. Its IUPAC name is N-[9-(6-amino-3-pyridinyl)-7-oxonon-8-enyl]-4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide.
| Compound Name | N-[9-(6-amino-3-pyridinyl)-7-oxonon-8-enyl]-4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175374182 |
| Molecular Formula | C34H32ClF3N6O4 |
| Molecular Weight | 681.12 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | N-[9-(6-amino-3-pyridinyl)-7-oxonon-8-enyl]-4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | Nc1ccc(C=CC(=O)CCCCCCNC(=O)c2cc(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)ccn2)cn1 |
| InChI | InChI=1S/C34H32ClF3N6O4/c35-29-14-10-24(19-28(29)34(36,37)38)44-33(47)43-23-8-12-26(13-9-23)48-27-16-18-40-30(20-27)32(46)41-17-4-2-1-3-5-25(45)11-6-22-7-15-31(39)42-21-22/h6-16,18-21H,1-5,17H2,(H2,39,42)(H,41,46)(H2,43,44,47) |
| InChIKey | CKTOJHXZODZONM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.12 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|