C28H18ClF6N5O3 — CID 141350522
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]pyridine-2-carboxamide (PubChem CID 141350522) has the molecular formula C28H18ClF6N5O3 and a molecular weight of 621.93 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141350522 |
| Molecular Formula | C28H18ClF6N5O3 |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-[[4-(trifluoromethyl)phenyl]methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccnc(C(=O)NN=Cc3ccc(C(F)(F)F)cc3)c2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H18ClF6N5O3/c29-23-10-7-19(13-22(23)28(33,34)35)39-26(42)38-18-5-8-20(9-6-18)43-21-11-12-36-24(14-21)25(41)40-37-15-16-1-3-17(4-2-16)27(30,31)32/h1-15H,(H,40,41)(H2,38,39,42) |
| InChIKey | MEFVVGLQUJBGFS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|